Page MenuHomec4science

nbls.py
No OneTemporary

File Metadata

Created
Wed, Jul 2, 12:34
# -*- coding: utf-8 -*-
# @Author: Theo Lemaire
# @Email: theo.lemaire@epfl.ch
# @Date: 2016-09-29 16:16:19
# @Last Modified by: Theo Lemaire
# @Last Modified time: 2020-04-24 10:42:51
import logging
import numpy as np
from .solvers import EventDrivenSolver, HybridSolver
from .bls import BilayerSonophore
from .pneuron import PointNeuron
from .model import Model
from .drives import AcousticDrive
from .protocols import *
from ..utils import *
from ..constants import *
from ..postpro import getFixedPoints
from .lookups import EffectiveVariablesLookup
from ..neurons import getPointNeuron
NEURONS_LOOKUP_DIR = os.path.abspath(os.path.split(__file__)[0] + "/../lookups/")
class NeuronalBilayerSonophore(BilayerSonophore):
''' This class inherits from the BilayerSonophore class and receives an PointNeuron instance
at initialization, to define the electro-mechanical NICE model and its SONIC variant. '''
tscale = 'ms' # relevant temporal scale of the model
simkey = 'ASTIM' # keyword used to characterize simulations made with this model
def __init__(self, a, pneuron, embedding_depth=0.0):
''' Constructor of the class.
:param a: in-plane radius of the sonophore structure within the membrane (m)
:param pneuron: point-neuron model
:param embedding_depth: depth of the embedding tissue around the membrane (m)
'''
self.pneuron = pneuron
super().__init__(a, pneuron.Cm0, pneuron.Qm0, embedding_depth=embedding_depth)
@property
def a_str(self):
return f'{self.a * 1e9:.1f} nm'
def __repr__(self):
s = f'{self.__class__.__name__}({self.a_str}, {self.pneuron}'
if self.d > 0.:
s += f', d={si_format(self.d, precision=1)}m'
return f'{s})'
def copy(self):
return self.__class__(self.a, self.pneuron, embedding_depth=self.d)
def __eq__(self, other):
if not isinstance(other, self.__class__):
return False
return self.a == other.a and self.pneuron == other.pneuron and self.d == other.d
@property
def pneuron(self):
return self._pneuron
@pneuron.setter
def pneuron(self, value):
if not isinstance(value, PointNeuron):
raise ValueError(f'{value} is not a valid PointNeuron instance')
if not hasattr(self, '_pneuron') or value != self._pneuron:
self._pneuron = value
if hasattr(self, 'a'):
super().__init__(self.a, self.pneuron.Cm0, self.pneuron.Qm0, embedding_depth=self.d)
@property
def meta(self):
return {
'neuron': self.pneuron.name,
'a': self.a,
'd': self.d,
}
@classmethod
def initFromMeta(cls, meta):
return cls(meta['a'], getPointNeuron(meta['neuron']), embedding_depth=meta['d'])
def params(self):
return {**super().params(), **self.pneuron.params()}
def getPltVars(self, wrapleft='df["', wrapright='"]'):
return {**super().getPltVars(wrapleft, wrapright),
**self.pneuron.getPltVars(wrapleft, wrapright)}
@property
def pltScheme(self):
return self.pneuron.pltScheme
def filecode(self, *args):
return Model.filecode(self, *args)
@staticmethod
def inputs():
# Get parent input vars and supress irrelevant entries
inputvars = BilayerSonophore.inputs()
del inputvars['Qm']
# Fill in current input vars in appropriate order
inputvars.update({
**AcousticDrive.inputs(),
'fs': {
'desc': 'sonophore membrane coverage fraction',
'label': 'f_s',
'unit': '\%',
'factor': 1e2,
'precision': 0
},
'method': None
})
return inputvars
def filecodes(self, drive, pp, fs, method, qss_vars):
codes = {
'simkey': self.simkey,
'neuron': self.pneuron.name,
'nature': pp.nature,
'a': f'{self.a * 1e9:.0f}nm',
**drive.filecodes,
**pp.filecodes,
}
codes['fs'] = f'fs{fs * 1e2:.0f}%' if fs < 1 else None
codes['method'] = method
codes['qss_vars'] = qss_vars
return codes
@staticmethod
def interpEffVariable(key, Qm, stim, lkp):
''' Interpolate Q-dependent effective variable along various stimulation states of a solution.
:param key: lookup variable key
:param Qm: charge density solution vector
:param stim: stimulation state solution vector
:param lkp: 2D lookup object
:return: interpolated effective variable vector
'''
x = np.zeros(stim.size)
stim_vals = np.unique(stim)
for s in stim_vals:
x[stim == s] = lkp.project('A', s).interpVar1D(Qm[stim == s], key)
return x
@staticmethod
def spatialAverage(fs, x, x0):
''' fs-modulated spatial averaging. '''
return fs * x + (1 - fs) * x0
@timer
def computeEffVars(self, drive, Qm, fs):
''' Compute "effective" coefficients of the HH system for a specific
acoustic stimulus and charge density.
A short mechanical simulation is run while imposing the specific charge density,
until periodic stabilization. The HH coefficients are then averaged over the last
acoustic cycle to yield "effective" coefficients.
:param drive: acoustic drive object
:param Qm: imposed charge density (C/m2)
:param fs: list of sonophore membrane coverage fractions
:return: list with computation time and a list of dictionaries of effective variables
'''
# Run simulation and retrieve deflection and gas content vectors from last cycle
data = super().simCycles(drive, Qm)
Z_last = data.loc[-NPC_DENSE:, 'Z'].values # m
Cm_last = self.v_capacitance(Z_last) # F/m2
# For each coverage fraction
effvars = []
for x in fs:
# Compute membrane capacitance and membrane potential vectors
Cm = self.spatialAverage(x, Cm_last, self.Cm0) # F/m2
Vm = Qm / Cm * 1e3 # mV
# Compute average cycle value for membrane potential and rate constants
effvars.append({**{'V': np.mean(Vm)}, **self.pneuron.getEffRates(Vm)})
# Log process
log = f'{self}: lookups @ {drive.desc}, {Qm * 1e5:.2f} nC/cm2'
if len(fs) > 1:
log += f', fs = {fs.min() * 1e2:.0f} - {fs.max() * 1e2:.0f}%'
logger.info(log)
# Return effective coefficients
return effvars
def getLookupFileName(self, a=None, f=None, A=None, fs=False):
fname = f'{self.pneuron.name}_lookups'
if a is not None:
fname += f'_{a * 1e9:.0f}nm'
if f is not None:
fname += f'_{f * 1e-3:.0f}kHz'
if A is not None:
fname += f'_{A * 1e-3:.0f}kPa'
if fs is True:
fname += '_fs'
return f'{fname}.pkl'
def getLookupFilePath(self, *args, **kwargs):
return os.path.join(NEURONS_LOOKUP_DIR, self.getLookupFileName(*args, **kwargs))
def getLookup(self, *args, **kwargs):
keep_tcomp = kwargs.pop('keep_tcomp', False)
lookup_path = self.getLookupFilePath(*args, **kwargs)
lkp = EffectiveVariablesLookup.fromPickle(lookup_path)
if not keep_tcomp:
del lkp.tables['tcomp']
return lkp
def getLookup2D(self, f, fs):
proj_kwargs = {'a': self.a, 'f': f, 'fs': fs}
if fs < 1.:
kwargs = proj_kwargs.copy()
kwargs['fs'] = True
else:
kwargs = {}
return self.getLookup(**kwargs).projectN(proj_kwargs)
def fullDerivatives(self, t, y, drive, fs):
''' Compute the full system derivatives.
:param t: specific instant in time (s)
:param y: vector of state variables
:param drive: acoustic drive object
:param fs: sonophore membrane coverage fraction (-)
:return: vector of derivatives
'''
dydt_mech = BilayerSonophore.derivatives(
self, t, y[:3], drive, y[3])
dydt_elec = self.pneuron.derivatives(
t, y[3:], Cm=self.spatialAverage(fs, self.capacitance(y[1]), self.Cm0))
return dydt_mech + dydt_elec
def effDerivatives(self, t, y, lkp1d, qss_vars):
''' Compute the derivatives of the n-ODE effective system variables,
based on 1-dimensional linear interpolation of "effective" coefficients
that summarize the system's behaviour over an acoustic cycle.
:param t: specific instant in time (s)
:param y: vector of HH system variables at time t
:param lkp: dictionary of 1D data points of "effective" coefficients
over the charge domain, for specific frequency and amplitude values.
:param qss_vars: list of QSS variables
:return: vector of effective system derivatives at time t
'''
# Unpack values and interpolate lookup at current charge density
Qm, *states = y
lkp0d = lkp1d.interpolate1D(Qm)
# Compute states dictionary from differential and QSS variables
states_dict = {}
i = 0
for k in self.pneuron.statesNames():
if k in qss_vars:
states_dict[k] = self.pneuron.quasiSteadyStates()[k](lkp0d)
else:
states_dict[k] = states[i]
i += 1
# Compute charge density derivative
dQmdt = - self.pneuron.iNet(lkp0d['V'], states_dict) * 1e-3
# Compute states derivative vector only for differential variable
dstates = []
for k in self.pneuron.statesNames():
if k not in qss_vars:
dstates.append(self.pneuron.derEffStates()[k](lkp0d, states_dict))
return [dQmdt, *dstates]
def deflectionDependentVm(self, Qm, Z, fs):
''' Compute deflection (and sonopphore coverage fraction) dependent voltage profile. '''
return Qm / self.spatialAverage(fs, self.v_capacitance(Z), self.Cm0) * 1e3 # mV
def fullInitialConditions(self, *args, **kwargs):
''' Compute simulation initial conditions. '''
y0 = super().initialConditions(*args, **kwargs)
y0.update({
'Qm': [self.Qm0] * 2,
**{k: [self.pneuron.steadyStates()[k](self.pneuron.Vm0)] * 2
for k in self.pneuron.statesNames()}
})
return y0
def __simFull(self, drive, pp, fs):
# Compute initial conditions
y0 = self.fullInitialConditions(drive, self.Qm0, drive.dt)
# Initialize solver and compute solution
solver = EventDrivenSolver(
lambda x: setattr(solver.drive, 'xvar', drive.xvar * x), # eventfunc
y0.keys(), # variables list
lambda t, y: self.fullDerivatives(t, y, solver.drive, fs), # dfunc
event_params={'drive': drive.copy().updatedX(0.)}, # event parameters
dt=drive.dt) # time step
data = solver(
y0, pp.stimEvents(), pp.tstop, target_dt=CLASSIC_TARGET_DT,
log_period=pp.tstop / 100 if logger.getEffectiveLevel() < logging.INFO else None,
# logfunc=lambda y: f'Qm = {y[3] * 1e5:.2f} nC/cm2'
)
# Remove velocity and add voltage timeseries to solution
del data['U']
data = addColumn(
data, 'Vm', self.deflectionDependentVm(data['Qm'], data['Z'], fs), preceding_key='Qm')
# Return solution dataframe
return data
def __simHybrid(self, drive, pp, fs):
# Compute initial conditions
y0 = self.fullInitialConditions(drive, self.Qm0, drive.dt)
# Initialize solver and compute solution
solver = HybridSolver(
y0.keys(),
lambda t, y: self.fullDerivatives(t, y, solver.drive, fs), # dfunc
lambda t, y, Cm: self.pneuron.derivatives(
t, y, Cm=self.spatialAverage(fs, Cm, self.Cm0)), # dfunc_sparse
lambda yref: self.capacitance(yref[1]), # predfunc
lambda x: setattr(solver.drive, 'xvar', drive.xvar * x), # eventfunc
drive.periodicity, # periodicity
['U', 'Z', 'ng'], # fast-evolving variables
drive.dt, # dense time step
drive.dt_sparse, # sparse time step
event_params={'drive': drive.copy().updatedX(0.)}, # event parameters
primary_vars=['Z', 'ng'] # primary variables
)
data = solver(
y0, pp.stimEvents(), pp.tstop, HYBRID_UPDATE_INTERVAL, target_dt=CLASSIC_TARGET_DT,
log_period=pp.tstop / 100 if logger.getEffectiveLevel() < logging.INFO else None,
logfunc=lambda y: f'Qm = {y[3] * 1e5:.2f} nC/cm2'
)
# Remove velocity and add voltage timeseries to solution
del data['U']
data = addColumn(
data, 'Vm', self.deflectionDependentVm(data['Qm'], data['Z'], fs), preceding_key='Qm')
# Return solution dataframe
return data
def __simSonic(self, drive, pp, fs, qss_vars=None, pavg=False):
# Load appropriate 2D lookup
lkp = self.getLookup2D(drive.f, fs)
# Adapt lookup and pulsing protocol if pulse-average mode is selected
if pavg:
lkp = lkp * pp.DC + lkp.project('A', 0.).tile('A', lkp.refs['A']) * (1 - pp.DC)
tstim = (int(pp.tstim * pp.PRF) - 1 + pp.DC) / pp.PRF
pp = TimeProtocol(tstim, pp.tstim + pp.toffset - tstim)
# Determine QSS and differential variables, and create optional QSS lookup
if qss_vars is None:
qss_vars = []
else:
lkp_QSS = EffectiveVariablesLookup(
lkp.refs, {k: self.pneuron.quasiSteadyStates()[k](lkp) for k in qss_vars})
diff_vars = [item for item in self.pneuron.statesNames() if item not in qss_vars]
# Set initial conditions
y0 = {
'Qm': self.Qm0,
**{k: self.pneuron.steadyStates()[k](self.pneuron.Vm0) for k in diff_vars}
}
# Initialize solver and compute solution
solver = EventDrivenSolver(
lambda x: setattr(solver, 'lkp', lkp.project('A', drive.xvar * x)), # eventfunc
y0.keys(), # variables list
lambda t, y: self.effDerivatives(t, y, solver.lkp, qss_vars), # dfunc
event_params={'lkp': lkp.project('A', 0.)}, # event parameters
dt=self.pneuron.chooseTimeStep()) # time step
data = solver(
y0, pp.stimEvents(), pp.tstop,
log_period=pp.tstop / 100 if pp.tstop >= 5 else None,
max_nsamples=MAX_NSAMPLES_EFFECTIVE)
# Interpolate Vm and QSS variables along charge vector and store them in solution dataframe
data = addColumn(
data, 'Vm', self.interpEffVariable('V', data['Qm'], data['stimstate'] * drive.A, lkp),
preceding_key='Qm')
for k in qss_vars:
data[k] = self.interpEffVariable(k, data['Qm'], data['stimstate'] * drive.A, lkp_QSS)
# Add dummy deflection and gas content vectors to solution
for key in ['Z', 'ng']:
data[key] = np.full(data['t'].size, np.nan)
# Return solution dataframe
return data
def intMethods(self):
''' Listing of model integration methods. '''
return {
'full': self.__simFull,
'hybrid': self.__simHybrid,
'sonic': self.__simSonic
}
@classmethod
@Model.checkOutputDir
def simQueue(cls, freqs, amps, durations, offsets, PRFs, DCs, fs, methods, qss_vars, **kwargs):
''' Create a serialized 2D array of all parameter combinations for a series of individual
parameter sweeps, while avoiding repetition of CW protocols for a given PRF sweep.
:param freqs: list (or 1D-array) of US frequencies
:param amps: list (or 1D-array) of acoustic amplitudes
:param durations: list (or 1D-array) of stimulus durations
:param offsets: list (or 1D-array) of stimulus offsets (paired with durations array)
:param PRFs: list (or 1D-array) of pulse-repetition frequencies
:param DCs: list (or 1D-array) of duty cycle values
:param fs: sonophore membrane coverage fractions (-)
:params methods: integration methods
:param qss_vars: QSS variables
:return: list of parameters (list) for each simulation
'''
if ('full' in methods or 'hybrid' in methods) and kwargs['outputdir'] is None:
logger.warning('Running cumbersome simulation(s) without file saving')
if amps is None:
amps = [None]
drives = AcousticDrive.createQueue(freqs, amps)
protocols = PulsedProtocol.createQueue(durations, offsets, PRFs, DCs)
queue = []
for drive in drives:
for pp in protocols:
for cov in fs:
for method in methods:
queue.append([drive, pp, cov, method, qss_vars])
return queue
@classmethod
@Model.checkOutputDir
def simQueueBurst(cls, freqs, amps, durations, PRFs, DCs, BRFs, nbursts,
fs, methods, qss_vars, **kwargs):
if ('full' in methods or 'hybrid' in methods) and kwargs['outputdir'] is None:
logger.warning('Running cumbersome simulation(s) without file saving')
if amps is None:
amps = [None]
drives = AcousticDrive.createQueue(freqs, amps)
protocols = BurstProtocol.createQueue(durations, PRFs, DCs, BRFs, nbursts)
queue = []
for drive in drives:
for pp in protocols:
for cov in fs:
for method in methods:
queue.append([drive, pp, cov, method, qss_vars])
return queue
def checkInputs(self, drive, pp, fs, method, qss_vars):
PointNeuron.checkInputs(drive, pp)
_, xevents, = zip(*pp.stimEvents())
if np.any(np.array([xevents]) < 0.):
raise ValueError('Invalid time protocol: contains negative modulators')
if not isinstance(fs, float):
raise TypeError(f'Invalid "fs" parameter (must be float typed)')
if qss_vars is not None:
if not isIterable(qss_vars) or not isinstance(qss_vars[0], str):
raise ValueError('Invalid QSS variables: must be None or an iterable of strings')
sn = self.pneuron.statesNames()
for item in qss_vars:
if item not in sn:
raise ValueError(f'Invalid QSS variable: {item} (must be in {sn}')
if method not in list(self.intMethods().keys()):
raise ValueError(f'Invalid integration method: "{method}"')
@Model.logNSpikes
@Model.checkTitrate
@Model.addMeta
@Model.logDesc
@Model.checkSimParams
def simulate(self, drive, pp, fs=1., method='sonic', qss_vars=None):
''' Simulate the electro-mechanical model for a specific set of US stimulation parameters,
and return output data in a dataframe.
:param drive: acoustic drive object
:param pp: pulse protocol object
:param fs: sonophore membrane coverage fraction (-)
:param method: selected integration method
:return: output dataframe
'''
# Set the tissue elastic modulus
self.setTissueModulus(drive)
# Call appropriate simulation function and return
simfunc = self.intMethods()[method]
simargs = [drive, pp, fs]
if method == 'sonic':
simargs.append(qss_vars)
return simfunc(*simargs)
def desc(self, meta):
method = meta['method'] if 'method' in meta else meta['model']['method']
fs = meta['fs'] if 'fs' in meta else meta['model']['fs']
s = f'{self}: {method} simulation @ {meta["drive"].desc}, {meta["pp"].desc}'
if fs < 1.0:
s += f', fs = {(fs * 1e2):.2f}%'
if 'qss_vars' in meta and meta['qss_vars'] is not None:
s += f" - QSS ({', '.join(meta['qss_vars'])})"
return s
@staticmethod
def getNSpikes(data):
return PointNeuron.getNSpikes(data)
def getArange(self, drive):
return (0., self.getLookup().refs['A'].max())
@property
def titrationFunc(self):
return self.pneuron.titrationFunc
@logCache(os.path.join(os.path.split(__file__)[0], 'astim_titrations.log'))
def titrate(self, drive, pp, fs=1., method='sonic', qss_vars=None, xfunc=None, Arange=None):
''' Use a binary search to determine the threshold amplitude needed to obtain
neural excitation for a given frequency and pulsed protocol.
:param drive: unresolved acoustic drive object
:param pp: pulse protocol object
:param fs: sonophore membrane coverage fraction (-)
:param method: integration method
:return: determined threshold amplitude (Pa)
'''
return super().titrate(drive, pp, fs=fs, method=method, qss_vars=qss_vars,
xfunc=xfunc, Arange=Arange)
def getQuasiSteadyStates(self, f, amps=None, charges=None, DC=1.0, squeeze_output=False):
''' Compute the quasi-steady state values of the neuron's gating variables
for a combination of US amplitudes, charge densities,
at a specific US frequency and duty cycle.
:param f: US frequency (Hz)
:param amps: US amplitudes (Pa)
:param charges: membrane charge densities (C/m2)
:param DC: duty cycle
:return: 4-tuple with reference values of US amplitude and charge density,
as well as interpolated Vmeff and QSS gating variables
'''
# Get DC-averaged lookups interpolated at the appropriate amplitudes and charges
lkp = self.getLookup().projectDC(amps=amps, DC=DC).projectN({'a': self.a, 'f': f})
if charges is not None:
lkp = lkp.project('Q', charges)
# Specify dimensions with A as the first axis
lkp.move('A', 0)
# Compute QSS states using these lookups
QSS = EffectiveVariablesLookup(
lkp.refs,
{k: v(lkp) for k, v in self.pneuron.quasiSteadyStates().items()})
# Compress outputs if needed
if squeeze_output:
QSS = QSS.squeeze()
lkp = lkp.squeeze()
return lkp, QSS
def iNetQSS(self, Qm, f, A, DC):
''' Compute quasi-steady state net membrane current for a given combination
of US parameters and a given membrane charge density.
:param Qm: membrane charge density (C/m2)
:param f: US frequency (Hz)
:param A: US amplitude (Pa)
:param DC: duty cycle (-)
:return: net membrane current (mA/m2)
'''
lkp, QSS = self.getQuasiSteadyStates(
f, amps=A, charges=Qm, DC=DC, squeeze_output=True)
return self.pneuron.iNet(lkp['V'], QSS) # mA/m2
def fixedPointsQSS(self, f, A, DC, lkp, dQdt):
''' Compute QSS fixed points along the charge dimension for a given combination
of US parameters, and determine their stability.
:param f: US frequency (Hz)
:param A: US amplitude (Pa)
:param DC: duty cycle (-)
:param lkp: lookup dictionary for effective variables along charge dimension
:param dQdt: charge derivative profile along charge dimension
:return: 2-tuple with values of stable and unstable fixed points
'''
logger.debug(f'A = {A * 1e-3:.2f} kPa, DC = {DC * 1e2:.0f}%')
# Extract fixed points from QSS charge variation profile
def dfunc(Qm):
return - self.iNetQSS(Qm, f, A, DC)
fixed_points = getFixedPoints(
lkp.refs['Q'], dQdt, filter='both', der_func=dfunc).tolist()
dfunc = lambda x: np.array(self.effDerivatives(_, x, lkp))
# classified_fixed_points = {'stable': [], 'unstable': [], 'saddle': []}
classified_fixed_points = []
np.set_printoptions(precision=2)
# For each fixed point
for i, Qm in enumerate(fixed_points):
# Re-compute QSS at fixed point
*_, QSS = self.getQuasiSteadyStates(f, amps=A, charges=Qm, DC=DC,
squeeze_output=True)
# Classify fixed point stability by numerically evaluating its Jacobian and
# computing its eigenvalues
x = np.array([Qm, *QSS.tables.values()])
eigvals, key = classifyFixedPoint(x, dfunc)
# classified_fixed_points[key].append(Qm)
classified_fixed_points.append((x, eigvals, key))
# eigenvalues.append(eigvals)
logger.debug(f'{key} point @ Q = {(Qm * 1e5):.1f} nC/cm2')
# eigenvalues = np.array(eigenvalues).T
# print(eigenvalues.shape)
return classified_fixed_points
def isStableQSS(self, f, A, DC):
lookups, QSS = self.getQuasiSteadyStates(
f, amps=A, DCs=DC, squeeze_output=True)
dQdt = -self.pneuron.iNet(lookups['V'], QSS.tables) # mA/m2
classified_fixed_points = self.fixedPointsQSS(f, A, DC, lookups, dQdt)
return len(classified_fixed_points['stable']) > 0
class DrivenNeuronalBilayerSonophore(NeuronalBilayerSonophore):
simkey = 'DASTIM' # keyword used to characterize simulations made with this model
def __init__(self, Idrive, *args, **kwargs):
self.Idrive = Idrive
super().__init__(*args, **kwargs)
def __repr__(self):
return super().__repr__()[:-1] + f', Idrive = {self.Idrive:.2f} mA/m2)'
@classmethod
def initFromMeta(cls, meta):
return cls(meta['Idrive'], meta['a'], getPointNeuron(meta['neuron']),
embedding_depth=meta['d'])
def params(self):
return {**{'Idrive': self.Idrive}, **super().params()}
@staticmethod
def inputs():
return {
**NeuronalBilayerSonophore.inputs(),
'Idrive': {
'desc': 'driving current density',
'label': 'I_{drive}',
'unit': 'mA/m2',
'factor': 1e0,
'precision': 0
}
}
@property
def meta(self):
return {
**super().meta,
'Idrive': self.Idrive
}
def filecodes(self, *args):
return {
**super().filecodes(*args),
'Idrive': f'Idrive{self.Idrive:.1f}mAm2'
}
def fullDerivatives(self, *args):
dydt = super().fullDerivatives(*args)
dydt[3] += self.Idrive * 1e-3
return dydt
def effDerivatives(self, *args):
dQmdt, *dstates = super().effDerivatives(*args)
dQmdt += self.Idrive * 1e-3
return [dQmdt, *dstates]

Event Timeline