Page MenuHomec4science

nbls.py
No OneTemporary

File Metadata

Created
Wed, May 8, 22:23
# -*- coding: utf-8 -*-
# @Author: Theo Lemaire
# @Email: theo.lemaire@epfl.ch
# @Date: 2016-09-29 16:16:19
# @Last Modified by: Theo Lemaire
# @Last Modified time: 2020-04-15 20:20:33
import logging
import numpy as np
from .solvers import EventDrivenSolver, HybridSolver
from .bls import BilayerSonophore
from .pneuron import PointNeuron
from .model import Model
from .drives import Drive, AcousticDrive
from .protocols import TimeProtocol, PulsedProtocol
from ..utils import *
from ..constants import *
from ..postpro import getFixedPoints
from .lookups import EffectiveVariablesLookup
from ..neurons import getPointNeuron
NEURONS_LOOKUP_DIR = os.path.abspath(os.path.split(__file__)[0] + "/../lookups/")
class NeuronalBilayerSonophore(BilayerSonophore):
''' This class inherits from the BilayerSonophore class and receives an PointNeuron instance
at initialization, to define the electro-mechanical NICE model and its SONIC variant. '''
tscale = 'ms' # relevant temporal scale of the model
simkey = 'ASTIM' # keyword used to characterize simulations made with this model
def __init__(self, a, pneuron, embedding_depth=0.0):
''' Constructor of the class.
:param a: in-plane radius of the sonophore structure within the membrane (m)
:param pneuron: point-neuron model
:param embedding_depth: depth of the embedding tissue around the membrane (m)
'''
self.pneuron = pneuron
super().__init__(a, pneuron.Cm0, pneuron.Qm0, embedding_depth=embedding_depth)
@property
def a_str(self):
return f'{self.a * 1e9:.1f} nm'
def __repr__(self):
s = f'{self.__class__.__name__}({self.a_str}, {self.pneuron}'
if self.d > 0.:
s += f', d={si_format(self.d, precision=1)}m'
return f'{s})'
def copy(self):
return self.__class__(self.a, self.pneuron, embedding_depth=self.d)
def __eq__(self, other):
if not isinstance(other, self.__class__):
return False
return self.a == other.a and self.pneuron == other.pneuron and self.d == other.d
@property
def pneuron(self):
return self._pneuron
@pneuron.setter
def pneuron(self, value):
if not isinstance(value, PointNeuron):
raise ValueError(f'{value} is not a valid PointNeuron instance')
if not hasattr(self, '_pneuron') or value != self._pneuron:
self._pneuron = value
if hasattr(self, 'a'):
super().__init__(self.a, self.pneuron.Cm0, self.pneuron.Qm0, embedding_depth=self.d)
@property
def meta(self):
return {
'neuron': self.pneuron.name,
'a': self.a,
'd': self.d,
}
@classmethod
def initFromMeta(cls, meta):
return cls(meta['a'], getPointNeuron(meta['neuron']), embedding_depth=meta['d'])
def params(self):
return {**super().params(), **self.pneuron.params()}
def getPltVars(self, wrapleft='df["', wrapright='"]'):
return {**super().getPltVars(wrapleft, wrapright),
**self.pneuron.getPltVars(wrapleft, wrapright)}
@property
def pltScheme(self):
return self.pneuron.pltScheme
def filecode(self, *args):
return Model.filecode(self, *args)
@staticmethod
def inputs():
# Get parent input vars and supress irrelevant entries
inputvars = BilayerSonophore.inputs()
del inputvars['Qm']
# Fill in current input vars in appropriate order
inputvars.update({
**AcousticDrive.inputs(),
'fs': {
'desc': 'sonophore membrane coverage fraction',
'label': 'f_s',
'unit': '\%',
'factor': 1e2,
'precision': 0
},
'method': None
})
return inputvars
def filecodes(self, drive, pp, fs, method, qss_vars):
codes = {
'simkey': self.simkey,
'neuron': self.pneuron.name,
'nature': pp.nature,
'a': f'{self.a * 1e9:.0f}nm',
**drive.filecodes,
**pp.filecodes,
}
codes['fs'] = f'fs{fs * 1e2:.0f}%' if fs < 1 else None
codes['method'] = method
codes['qss_vars'] = qss_vars
return codes
@staticmethod
def interpEffVariable(key, Qm, stim, lkp):
''' Interpolate Q-dependent effective variable along various stimulation states of a solution.
:param key: lookup variable key
:param Qm: charge density solution vector
:param stim: stimulation state solution vector
:param lkp: 2D lookup object
:return: interpolated effective variable vector
'''
x = np.zeros(stim.size)
stim_vals = np.unique(stim)
for s in stim_vals:
x[stim == s] = lkp.project('A', s).interpVar1D(Qm[stim == s], key)
return x
@staticmethod
def spatialAverage(fs, x, x0):
''' fs-modulated spatial averaging. '''
return fs * x + (1 - fs) * x0
@timer
def computeEffVars(self, drive, Qm, fs):
''' Compute "effective" coefficients of the HH system for a specific
acoustic stimulus and charge density.
A short mechanical simulation is run while imposing the specific charge density,
until periodic stabilization. The HH coefficients are then averaged over the last
acoustic cycle to yield "effective" coefficients.
:param drive: acoustic drive object
:param Qm: imposed charge density (C/m2)
:param fs: list of sonophore membrane coverage fractions
:return: list with computation time and a list of dictionaries of effective variables
'''
# Run simulation and retrieve deflection and gas content vectors from last cycle
data = BilayerSonophore.simCycles(self, drive, Qm)
Z_last = data.loc[-NPC_DENSE:, 'Z'].values # m
Cm_last = self.v_capacitance(Z_last) # F/m2
# For each coverage fraction
effvars = []
for x in fs:
# Compute membrane capacitance and membrane potential vectors
Cm = self.spatialAverage(x, Cm_last, self.Cm0) # F/m2
Vm = Qm / Cm * 1e3 # mV
# Compute average cycle value for membrane potential and rate constants
effvars.append({**{'V': np.mean(Vm)}, **self.pneuron.getEffRates(Vm)})
# Log process
log = f'{self}: lookups @ {drive.desc}, {Qm * 1e5:.2f} nC/cm2'
if len(fs) > 1:
log += f', fs = {fs.min() * 1e2:.0f} - {fs.max() * 1e2:.0f}%'
logger.info(log)
# Return effective coefficients
return effvars
def getLookupFileName(self, a=None, f=None, A=None, fs=False):
fname = f'{self.pneuron.name}_lookups'
if a is not None:
fname += f'_{a * 1e9:.0f}nm'
if f is not None:
fname += f'_{f * 1e-3:.0f}kHz'
if A is not None:
fname += f'_{A * 1e-3:.0f}kPa'
if fs is True:
fname += '_fs'
return f'{fname}.pkl'
def getLookupFilePath(self, *args, **kwargs):
return os.path.join(NEURONS_LOOKUP_DIR, self.getLookupFileName(*args, **kwargs))
def getLookup(self, *args, **kwargs):
keep_tcomp = kwargs.pop('keep_tcomp', False)
lookup_path = self.getLookupFilePath(*args, **kwargs)
lkp = EffectiveVariablesLookup.fromPickle(lookup_path)
if not keep_tcomp:
del lkp.tables['tcomp']
return lkp
def getLookup2D(self, f, fs):
proj_kwargs = {'a': self.a, 'f': f, 'fs': fs}
if fs < 1.:
kwargs = proj_kwargs.copy()
kwargs['fs'] = True
else:
kwargs = {}
return self.getLookup(**kwargs).projectN(proj_kwargs)
def fullDerivatives(self, t, y, drive, fs):
''' Compute the full system derivatives.
:param t: specific instant in time (s)
:param y: vector of state variables
:param drive: acoustic drive object
:param fs: sonophore membrane coverage fraction (-)
:return: vector of derivatives
'''
dydt_mech = BilayerSonophore.derivatives(
self, t, y[:3], drive, y[3])
dydt_elec = self.pneuron.derivatives(
t, y[3:], Cm=self.spatialAverage(fs, self.capacitance(y[1]), self.Cm0))
return dydt_mech + dydt_elec
def effDerivatives(self, t, y, lkp1d, qss_vars):
''' Compute the derivatives of the n-ODE effective system variables,
based on 1-dimensional linear interpolation of "effective" coefficients
that summarize the system's behaviour over an acoustic cycle.
:param t: specific instant in time (s)
:param y: vector of HH system variables at time t
:param lkp: dictionary of 1D data points of "effective" coefficients
over the charge domain, for specific frequency and amplitude values.
:param qss_vars: list of QSS variables
:return: vector of effective system derivatives at time t
'''
# Unpack values and interpolate lookup at current charge density
Qm, *states = y
lkp0d = lkp1d.interpolate1D(Qm)
# Compute states dictionary from differential and QSS variables
states_dict = {}
i = 0
for k in self.pneuron.statesNames():
if k in qss_vars:
states_dict[k] = self.pneuron.quasiSteadyStates()[k](lkp0d)
else:
states_dict[k] = states[i]
i += 1
# Compute charge density derivative
dQmdt = - self.pneuron.iNet(lkp0d['V'], states_dict) * 1e-3
# Compute states derivative vector only for differential variable
dstates = []
for k in self.pneuron.statesNames():
if k not in qss_vars:
dstates.append(self.pneuron.derEffStates()[k](lkp0d, states_dict))
return [dQmdt, *dstates]
def deflectionDependentVm(self, Qm, Z, fs):
''' Compute deflection (and sonopphore coverage fraction) dependent voltage profile. '''
return Qm / self.spatialAverage(fs, self.v_capacitance(Z), self.Cm0) * 1e3 # mV
def computeInitialConditions(self, *args, **kwargs):
''' Compute simulation initial conditions. '''
y0 = super().computeInitialConditions(*args, **kwargs)
y0.update({
'Qm': [self.Qm0] * 2,
**{k: [self.pneuron.steadyStates()[k](self.pneuron.Vm0)] * 2
for k in self.pneuron.statesNames()}
})
return y0
def __simFull(self, drive, pp, fs):
# Determine time step
dt = drive.dt
# Compute initial conditions
y0 = self.computeInitialConditions(drive, self.Qm0, dt)
# Initialize solver and compute solution
solver = EventDrivenSolver(
y0.keys(),
lambda t, y: self.fullDerivatives(t, y, solver.drive, fs),
lambda x: setattr(solver.drive, 'A', drive.A * x),
event_params={'drive': drive.copy().updatedX(0.)},
dt=dt)
data = solver(
y0, pp.stimEvents(), pp.ttotal, target_dt=CLASSIC_TARGET_DT,
log_period=pp.ttotal / 100 if logger.getEffectiveLevel() < logging.INFO else None,
logfunc=lambda y: f'Qm = {y[3] * 1e5:.2f} nC/cm2'
)
# Remove velocity and add voltage timeseries to solution
del data['U']
data = addColumn(
data, 'Vm', self.deflectionDependentVm(data['Qm'], data['Z'], fs), preceding_key='Qm')
# Return solution dataframe
return data
def __simHybrid(self, drive, pp, fs):
# Determine time steps
dt_dense, dt_sparse = [drive.dt, drive.dt_sparse]
# Compute initial conditions
y0 = self.computeInitialConditions(drive, self.Qm0, dt_dense)
# Initialize solver and compute solution
dense_vars = ['U', 'Z', 'ng']
solver = HybridSolver(
y0.keys(),
lambda t, y: self.fullDerivatives(t, y, solver.drive, fs), # dfunc
lambda t, y, Cm: self.pneuron.derivatives(
t, y, Cm=self.spatialAverage(fs, Cm, self.Cm0)), # dfunc_sparse
lambda yref: self.capacitance(yref[1]), # predfunc
lambda x: setattr(solver.drive, 'A', drive.A * x), # eventfunc
drive.periodicity, dense_vars, dt_dense, dt_sparse,
event_params={'drive': drive.copy().updatedX(0.)},
primary_vars=['Z', 'ng']
)
data = solver(
y0, pp.stimEvents(), pp.ttotal, target_dt=CLASSIC_TARGET_DT,
log_period=pp.ttotal / 100 if logger.getEffectiveLevel() < logging.INFO else None,
logfunc=lambda y: f'Qm = {y[3] * 1e5:.2f} nC/cm2'
)
# Remove velocity and add voltage timeseries to solution
del data['U']
data = addColumn(
data, 'Vm', self.deflectionDependentVm(data['Qm'], data['Z'], fs), preceding_key='Qm')
# Return solution dataframe
return data
def __simSonic(self, drive, pp, fs, qss_vars=None, pavg=False):
# Load appropriate 2D lookup
lkp = self.getLookup2D(drive.f, fs)
# Adapt lookup and pulsing protocol if pulse-average mode is selected
if pavg:
lkp = lkp * pp.DC + lkp.project('A', 0.).tile('A', lkp.refs['A']) * (1 - pp.DC)
tstim = (int(pp.tstim * pp.PRF) - 1 + pp.DC) / pp.PRF
pp = TimeProtocol(tstim, pp.tstim + pp.toffset - tstim)
# Determine QSS and differential variables, and create optional QSS lookup
if qss_vars is None:
qss_vars = []
else:
lkp_QSS = EffectiveVariablesLookup(
lkp.refs, {k: self.pneuron.quasiSteadyStates()[k](lkp) for k in qss_vars})
diff_vars = [item for item in self.pneuron.statesNames() if item not in qss_vars]
# Set initial conditions
y0 = {
'Qm': self.Qm0,
**{k: self.pneuron.steadyStates()[k](self.pneuron.Vm0) for k in diff_vars}
}
# Initialize solver and compute solution
solver = EventDrivenSolver(
y0.keys(),
lambda t, y: self.effDerivatives(t, y, solver.lkp, qss_vars),
lambda x: setattr(solver, 'lkp', lkp.project('A', drive.A * x)),
dt=self.pneuron.chooseTimeStep())
data = solver(y0, pp.stimEvents(), pp.ttotal)
# Interpolate Vm and QSS variables along charge vector and store them in solution dataframe
data = addColumn(
data, 'Vm', self.interpEffVariable('V', data['Qm'], data['stimstate'] * drive.A, lkp),
preceding_key='Qm')
for k in qss_vars:
data[k] = self.interpEffVariable(k, data['Qm'], data['stimstate'] * drive.A, lkp_QSS)
# Add dummy deflection and gas content vectors to solution
for key in ['Z', 'ng']:
data[key] = np.full(data['t'].size, np.nan)
# Return solution dataframe
return data
def intMethods(self):
''' Listing of model integration methods. '''
return {
'full': self.__simFull,
'hybrid': self.__simHybrid,
'sonic': self.__simSonic
}
@classmethod
@Model.checkOutputDir
def simQueue(cls, freqs, amps, durations, offsets, PRFs, DCs, fs, methods, qss_vars, **kwargs):
''' Create a serialized 2D array of all parameter combinations for a series of individual
parameter sweeps, while avoiding repetition of CW protocols for a given PRF sweep.
:param freqs: list (or 1D-array) of US frequencies
:param amps: list (or 1D-array) of acoustic amplitudes
:param durations: list (or 1D-array) of stimulus durations
:param offsets: list (or 1D-array) of stimulus offsets (paired with durations array)
:param PRFs: list (or 1D-array) of pulse-repetition frequencies
:param DCs: list (or 1D-array) of duty cycle values
:param fs: sonophore membrane coverage fractions (-)
:params methods: integration methods
:param qss_vars: QSS variables
:return: list of parameters (list) for each simulation
'''
if ('full' in methods or 'hybrid' in methods) and kwargs['outputdir'] is None:
logger.warning('Running cumbersome simulation(s) without file saving')
if amps is None:
amps = [None]
drives = AcousticDrive.createQueue(freqs, amps)
protocols = PulsedProtocol.createQueue(durations, offsets, PRFs, DCs)
queue = []
for drive in drives:
for pp in protocols:
for cov in fs:
for method in methods:
queue.append([drive, pp, cov, method, qss_vars])
return queue
def checkInputs(self, drive, pp, fs, method, qss_vars):
if not isinstance(drive, Drive):
raise TypeError(f'Invalid "drive" parameter (must be an "Drive" object)')
if not isinstance(pp, PulsedProtocol):
raise TypeError('Invalid pulsed protocol (must be "PulsedProtocol" instance)')
if not isinstance(fs, float):
raise TypeError(f'Invalid "fs" parameter (must be float typed)')
if qss_vars is not None:
if not isIterable(qss_vars) or not isinstance(qss_vars[0], str):
raise ValueError('Invalid QSS variables: must be None or an iterable of strings')
sn = self.pneuron.statesNames()
for item in qss_vars:
if item not in sn:
raise ValueError(f'Invalid QSS variable: {item} (must be in {sn}')
if method not in list(self.intMethods().keys()):
raise ValueError(f'Invalid integration method: "{method}"')
@Model.logNSpikes
@Model.checkTitrate
@Model.addMeta
@Model.logDesc
@Model.checkSimParams
def simulate(self, drive, pp, fs=1., method='sonic', qss_vars=None):
''' Simulate the electro-mechanical model for a specific set of US stimulation parameters,
and return output data in a dataframe.
:param drive: acoustic drive object
:param pp: pulse protocol object
:param fs: sonophore membrane coverage fraction (-)
:param method: selected integration method
:return: output dataframe
'''
# Set the tissue elastic modulus
self.setTissueModulus(drive)
# Call appropriate simulation function and return
simfunc = self.intMethods()[method]
simargs = [drive, pp, fs]
if method == 'sonic':
simargs.append(qss_vars)
return simfunc(*simargs)
def desc(self, meta):
method = meta['method'] if 'method' in meta else meta['model']['method']
fs = meta['fs'] if 'fs' in meta else meta['model']['fs']
s = f'{self}: {method} simulation @ {meta["drive"].desc}, {meta["pp"].desc}'
if fs < 1.0:
s += f', fs = {(fs * 1e2):.2f}%'
if 'qss_vars' in meta and meta['qss_vars'] is not None:
s += f" - QSS ({', '.join(meta['qss_vars'])})"
return s
@staticmethod
def getNSpikes(data):
return PointNeuron.getNSpikes(data)
def getArange(self, drive):
return (0., self.getLookup().refs['A'].max())
@property
def titrationFunc(self):
return self.pneuron.titrationFunc
@logCache(os.path.join(os.path.split(__file__)[0], 'astim_titrations.log'))
def titrate(self, drive, pp, fs=1., method='sonic', qss_vars=None, xfunc=None, Arange=None):
''' Use a binary search to determine the threshold amplitude needed to obtain
neural excitation for a given frequency and pulsed protocol.
:param drive: unresolved acoustic drive object
:param pp: pulse protocol object
:param fs: sonophore membrane coverage fraction (-)
:param method: integration method
:return: determined threshold amplitude (Pa)
'''
return super().titrate(drive, pp, fs=fs, method=method, qss_vars=qss_vars,
xfunc=xfunc, Arange=Arange)
def getQuasiSteadyStates(self, f, amps=None, charges=None, DC=1.0, squeeze_output=False):
''' Compute the quasi-steady state values of the neuron's gating variables
for a combination of US amplitudes, charge densities,
at a specific US frequency and duty cycle.
:param f: US frequency (Hz)
:param amps: US amplitudes (Pa)
:param charges: membrane charge densities (C/m2)
:param DC: duty cycle
:return: 4-tuple with reference values of US amplitude and charge density,
as well as interpolated Vmeff and QSS gating variables
'''
# Get DC-averaged lookups interpolated at the appropriate amplitudes and charges
lkp = self.getLookup().projectDC(amps=amps, DC=DC).projectN({'a': self.a, 'f': f})
if charges is not None:
lkp = lkp.project('Q', charges)
# Specify dimensions with A as the first axis
A_axis = lkp.getAxisIndex('A')
lkp.move('A', 0)
nA = lkp.dims()[0]
# Compute QSS states using these lookups
QSS = EffectiveVariablesLookup(
lkp.refs,
{k: v(lkp) for k, v in self.pneuron.quasiSteadyStates().items()})
# Compress outputs if needed
if squeeze_output:
QSS = QSS.squeeze()
lkp = lkp.squeeze()
return lkp, QSS
def iNetQSS(self, Qm, f, A, DC):
''' Compute quasi-steady state net membrane current for a given combination
of US parameters and a given membrane charge density.
:param Qm: membrane charge density (C/m2)
:param f: US frequency (Hz)
:param A: US amplitude (Pa)
:param DC: duty cycle (-)
:return: net membrane current (mA/m2)
'''
lkp, QSS = self.getQuasiSteadyStates(
f, amps=A, charges=Qm, DC=DC, squeeze_output=True)
return self.pneuron.iNet(lkp['V'], QSS) # mA/m2
def fixedPointsQSS(self, f, A, DC, lkp, dQdt):
''' Compute QSS fixed points along the charge dimension for a given combination
of US parameters, and determine their stability.
:param f: US frequency (Hz)
:param A: US amplitude (Pa)
:param DC: duty cycle (-)
:param lkp: lookup dictionary for effective variables along charge dimension
:param dQdt: charge derivative profile along charge dimension
:return: 2-tuple with values of stable and unstable fixed points
'''
pltvars = self.getPltVars()
logger.debug(f'A = {A * 1e-3:.2f} kPa, DC = {DC * 1e2:.0f}%')
# Extract fixed points from QSS charge variation profile
def dfunc(Qm):
return - self.iNetQSS(Qm, f, A, DC)
fixed_points = getFixedPoints(
lkp.refs['Q'], dQdt, filter='both', der_func=dfunc).tolist()
dfunc = lambda x: np.array(self.effDerivatives(_, x, lkp))
# classified_fixed_points = {'stable': [], 'unstable': [], 'saddle': []}
classified_fixed_points = []
np.set_printoptions(precision=2)
# For each fixed point
for i, Qm in enumerate(fixed_points):
# Re-compute QSS at fixed point
*_, QSS = self.getQuasiSteadyStates(f, amps=A, charges=Qm, DC=DC,
squeeze_output=True)
# Classify fixed point stability by numerically evaluating its Jacobian and
# computing its eigenvalues
x = np.array([Qm, *QSS.tables.values()])
eigvals, key = classifyFixedPoint(x, dfunc)
# classified_fixed_points[key].append(Qm)
classified_fixed_points.append((x, eigvals, key))
# eigenvalues.append(eigvals)
logger.debug(f'{key} point @ Q = {(Qm * 1e5):.1f} nC/cm2')
# eigenvalues = np.array(eigenvalues).T
# print(eigenvalues.shape)
return classified_fixed_points
def isStableQSS(self, f, A, DC):
lookups, QSS = self.getQuasiSteadyStates(
f, amps=A, DCs=DC, squeeze_output=True)
dQdt = -self.pneuron.iNet(lookups['V'], QSS.tables) # mA/m2
classified_fixed_points = self.fixedPointsQSS(f, A, DC, lookups, dQdt)
return len(classified_fixed_points['stable']) > 0
class DrivenNeuronalBilayerSonophore(NeuronalBilayerSonophore):
simkey = 'DASTIM' # keyword used to characterize simulations made with this model
def __init__(self, Idrive, *args, **kwargs):
self.Idrive = Idrive
super().__init__(*args, **kwargs)
def __repr__(self):
return super().__repr__()[:-1] + f', Idrive = {self.Idrive:.2f} mA/m2)'
@classmethod
def initFromMeta(cls, meta):
return cls(meta['Idrive'], meta['a'], getPointNeuron(meta['neuron']), embedding_depth=meta['d'])
def params(self):
return {**{'Idrive': self.Idrive}, **super().params()}
@staticmethod
def inputs():
inputvars = NeuronalBilayerSonophore.inputs()
inputvars['Idrive'] = {
'desc': 'driving current density',
'label': 'I_{drive}',
'unit': 'mA/m2',
'factor': 1e0,
'precision': 0
}
return inputvars
def filecodes(self, *args):
codes = super().filecodes(*args)
codes['Idrive'] = f'Idrive{self.Idrive:.1f}mAm2'
return codes
def fullDerivatives(self, *args):
dydt = super().fullDerivatives(*args)
dydt[3] += self.Idrive * 1e-3
return dydt
def effDerivatives(self, *args):
dQmdt, *dstates = super().effDerivatives(*args)
dQmdt += self.Idrive * 1e-3
return [dQmdt, *dstates]
def meta(self, drive, pp, fs, method, qss_vars):
d = super().meta(drive, pp, fs, method, qss_vars)
d['Idrive'] = self.Idrive
return d

Event Timeline