Page MenuHomec4science

nbls.py
No OneTemporary

File Metadata

Created
Tue, May 14, 03:03
# -*- coding: utf-8 -*-
# @Author: Theo Lemaire
# @Email: theo.lemaire@epfl.ch
# @Date: 2016-09-29 16:16:19
# @Last Modified by: Theo Lemaire
# @Last Modified time: 2019-08-30 16:33:10
from copy import deepcopy
import logging
import numpy as np
import numdifftools as nd
import pandas as pd
from scipy import linalg
from .simulators import PWSimulator, HybridSimulator, PeriodicSimulator
from .bls import BilayerSonophore
from .pneuron import PointNeuron
from .model import Model
from .batches import Batch
from ..utils import *
from ..constants import *
from ..postpro import getFixedPoints
from .lookups import SmartLookup, SmartDict, fixLookup
NEURONS_LOOKUP_DIR = os.path.abspath(os.path.split(__file__)[0] + "/../neurons/")
class NeuronalBilayerSonophore(BilayerSonophore):
''' This class inherits from the BilayerSonophore class and receives an PointNeuron instance
at initialization, to define the electro-mechanical NICE model and its SONIC variant. '''
tscale = 'ms' # relevant temporal scale of the model
simkey = 'ASTIM' # keyword used to characterize simulations made with this model
def __init__(self, a, pneuron, Fdrive=None, embedding_depth=0.0):
''' Constructor of the class.
:param a: in-plane radius of the sonophore structure within the membrane (m)
:param pneuron: point-neuron model
:param Fdrive: frequency of acoustic perturbation (Hz)
:param embedding_depth: depth of the embedding tissue around the membrane (m)
'''
# Check validity of input parameters
if not isinstance(pneuron, PointNeuron):
raise ValueError('Invalid neuron type: "{}" (must inherit from PointNeuron class)'
.format(pneuron.name))
self.pneuron = pneuron
# Initialize BilayerSonophore parent object
BilayerSonophore.__init__(self, a, pneuron.Cm0, pneuron.Qm0(), embedding_depth)
def __repr__(self):
s = '{}({:.1f} nm, {}'.format(self.__class__.__name__, self.a * 1e9, self.pneuron)
if self.d > 0.:
s += ', d={}m'.format(si_format(self.d, precision=1, space=' '))
return s + ')'
def params(self):
return {**super().params(), **self.pneuron.params()}
def getPltVars(self, wrapleft='df["', wrapright='"]'):
return {**super().getPltVars(wrapleft, wrapright),
**self.pneuron.getPltVars(wrapleft, wrapright)}
def getPltScheme(self):
return self.pneuron.getPltScheme()
def filecode(self, *args):
return Model.filecode(self, *args)
@staticmethod
def inputs():
# Get parent input vars and supress irrelevant entries
bls_vars = BilayerSonophore.inputs()
pneuron_vars = PointNeuron.inputs()
del bls_vars['Qm']
del pneuron_vars['Astim']
# Fill in current input vars in appropriate order
inputvars = bls_vars
inputvars.update(pneuron_vars)
inputvars['fs'] = {
'desc': 'sonophore membrane coverage fraction',
'label': 'f_s',
'unit': '\%',
'factor': 1e2,
'precision': 0
}
inputvars['method'] = None
return inputvars
def filecodes(self, Fdrive, Adrive, tstim, toffset, PRF, DC, fs, method):
# Get parent codes and supress irrelevant entries
bls_codes = super().filecodes(Fdrive, Adrive, 0.0)
pneuron_codes = self.pneuron.filecodes(0.0, tstim, toffset, PRF, DC)
for x in [bls_codes, pneuron_codes]:
del x['simkey']
del bls_codes['Qm']
del pneuron_codes['Astim']
# Fill in current codes in appropriate order
codes = {
'simkey': self.simkey,
'neuron': pneuron_codes.pop('neuron'),
'nature': pneuron_codes.pop('nature')
}
codes.update(bls_codes)
codes.update(pneuron_codes)
codes['fs'] = 'fs{:.0f}%'.format(fs * 1e2) if fs < 1 else None
codes['method'] = method
return codes
@staticmethod
def interpOnOffVariable(key, Qm, stim, lkp):
''' Interpolate Q-dependent effective variable along ON and OFF periods of a solution.
:param key: lookup variable key
:param Qm: charge density solution vector
:param stim: stimulation state solution vector
:param lkp: dictionary of lookups for ON and OFF states
:return: interpolated effective variable vector
'''
x = np.zeros(stim.size)
x[stim == 0] = lkp['OFF'].interpVar(Qm[stim == 0], 'Q', key)
x[stim == 1] = lkp['ON'].interpVar(Qm[stim == 1], 'Q', key)
return x
@staticmethod
def spatialAverage(fs, x, x0):
''' fs-modulated spatial averaging. '''
return fs * x + (1 - fs) * x0
def computeEffVars(self, Fdrive, Adrive, Qm, fs):
''' Compute "effective" coefficients of the HH system for a specific
combination of stimulus frequency, stimulus amplitude and charge density.
A short mechanical simulation is run while imposing the specific charge density,
until periodic stabilization. The HH coefficients are then averaged over the last
acoustic cycle to yield "effective" coefficients.
:param Fdrive: acoustic drive frequency (Hz)
:param Adrive: acoustic drive amplitude (Pa)
:param Qm: imposed charge density (C/m2)
:param fs: list of sonophore membrane coverage fractions
:return: list with computation time and a list of dictionaries of effective variables
'''
# Run simulation and retrieve deflection and gas content vectors from last cycle
data, meta = BilayerSonophore.simulate(self, Fdrive, Adrive, Qm)
Z_last = data.loc[-NPC_DENSE:, 'Z'].values # m
Cm_last = self.v_capacitance(Z_last) # F/m2
# For each coverage fraction
effvars = []
for x in fs:
# Compute membrane capacitance and membrane potential vectors
Cm = self.spatialAverage(x, Cm_last, self.Cm0) # F/m2
Vm = Qm / Cm * 1e3 # mV
# Compute average cycle value for membrane potential and rate constants
effvars.append({**{'V': np.mean(Vm)}, **self.pneuron.getEffRates(Vm)})
# Log process
log = '{}: lookups @ {}Hz, {}Pa, {:.2f} nC/cm2'.format(
self, *si_format([Fdrive, Adrive], precision=1, space=' '), Qm * 1e5)
if len(fs) > 1:
log += ', fs = {:.0f} - {:.0f}%'.format(fs.min() * 1e2, fs.max() * 1e2)
log += ', tcomp = {:.3f} s'.format(meta['tcomp'])
logger.info(log)
# Return effective coefficients
return [meta['tcomp'], effvars]
def getLookupFileName(self, a=None, Fdrive=None, Adrive=None, fs=False):
fname = '{}_lookups'.format(self.pneuron.name)
if a is not None:
fname += '_{:.0f}nm'.format(a * 1e9)
if Fdrive is not None:
fname += '_{:.0f}kHz'.format(Fdrive * 1e-3)
if Adrive is not None:
fname += '_{:.0f}kPa'.format(Adrive * 1e-3)
if fs is True:
fname += '_fs'
return '{}.pkl'.format(fname)
def getLookupFilePath(self, *args, **kwargs):
return os.path.join(NEURONS_LOOKUP_DIR, self.getLookupFileName(*args, **kwargs))
def getLookup(self, *args, **kwargs):
lookup_path = self.getLookupFilePath(*args, **kwargs)
if not os.path.isfile(lookup_path):
raise FileNotFoundError('Missing lookup file: "{}"'.format(lookup_path))
with open(lookup_path, 'rb') as fh:
frame = pickle.load(fh)
if 'ng' in frame['lookup']:
del frame['lookup']['ng']
refs = frame['input']
# Move fs to last reference dimension
keys = list(refs.keys())
if 'fs' in keys and keys.index('fs') < len(keys) - 1:
del keys[keys.index('fs')]
keys.append('fs')
refs = {k: refs[k] for k in keys}
lkp = SmartLookup(refs, frame['lookup'])
return fixLookup(lkp)
def getLookup2D(self, Fdrive, fs):
if fs < 1:
lkp2d = self.getLookup(a=self.a, Fdrive=Fdrive, fs=True).project('fs', fs)
else:
lkp2d = self.getLookup().projectN({'a': self.a, 'f': Fdrive})
return lkp2d
def fullDerivatives(self, t, y, Fdrive, Adrive, phi, fs):
''' Compute the full system derivatives.
:param t: specific instant in time (s)
:param y: vector of state variables
:param Fdrive: acoustic drive frequency (Hz)
:param Adrive: acoustic drive amplitude (Pa)
:param phi: acoustic drive phase (rad)
:param fs: sonophore membrane coevrage fraction (-)
:return: vector of derivatives
'''
dydt_mech = BilayerSonophore.derivatives(
self, t, y[:3], Fdrive, Adrive, y[3], phi)
dydt_elec = self.pneuron.derivatives(
t, y[3:], Cm=self.spatialAverage(fs, self.capacitance(y[1]), self.Cm0))
return dydt_mech + dydt_elec
def effDerivatives(self, t, y, lkp1d):
''' Compute the derivatives of the n-ODE effective HH system variables,
based on 1-dimensional linear interpolation of "effective" coefficients
that summarize the system's behaviour over an acoustic cycle.
:param t: specific instant in time (s)
:param y: vector of HH system variables at time t
:param lkp: dictionary of 1D data points of "effective" coefficients
over the charge domain, for specific frequency and amplitude values.
:return: vector of effective system derivatives at time t
'''
Qm, *states = y
states_dict = dict(zip(self.pneuron.statesNames(), states))
lkp0d = lkp1d.interpolate1D('Q', Qm)
dQmdt = - self.pneuron.iNet(lkp0d['V'], states_dict) * 1e-3
return [dQmdt, *self.pneuron.getDerEffStates(lkp0d, states_dict)]
def __simFull(self, Fdrive, Adrive, tstim, toffset, PRF, DC, fs, phi=np.pi):
# Determine time step
dt = 1 / (NPC_DENSE * Fdrive)
# Compute initial non-zero deflection
Z = self.computeInitialDeflection(Adrive, Fdrive, phi, self.Qm0, dt)
# Set initial conditions
ss0 = self.pneuron.getSteadyStates(self.pneuron.Vm0)
y0 = np.concatenate(([0., 0., self.ng0, self.Qm0], ss0))
y1 = np.concatenate(([0., Z, self.ng0, self.Qm0], ss0))
# Initialize simulator and compute solution
logger.debug('Computing detailed solution')
simulator = PWSimulator(
lambda t, y: self.fullDerivatives(t, y, Fdrive, Adrive, phi, fs),
lambda t, y: self.fullDerivatives(t, y, 0., 0., 0., fs))
t, y, stim = simulator(
y1, dt, tstim, toffset, PRF, DC,
print_progress=logger.getEffectiveLevel() <= logging.INFO,
target_dt=CLASSIC_TARGET_DT)
# Prepend initial conditions (prior to stimulation)
t, y, stim = simulator.prependSolution(t, y, stim, y0=y0)
# Store output in dataframe and return
data = pd.DataFrame({
't': t,
'stimstate': stim,
'Z': y[:, 1],
'ng': y[:, 2],
'Qm': y[:, 3]
})
data['Vm'] = data['Qm'].values / self.spatialAverage(
fs, self.v_capacitance(data['Z'].values), self.Cm0) * 1e3 # mV
for i in range(len(self.pneuron.states)):
data[self.pneuron.statesNames()[i]] = y[:, i + 4]
return data
def __simHybrid(self, Fdrive, Adrive, tstim, toffset, PRF, DC, fs, phi=np.pi):
# Determine time steps
dt_dense, dt_sparse = [1. / (n * Fdrive) for n in [NPC_DENSE, NPC_SPARSE]]
# Compute initial non-zero deflection
Z = self.computeInitialDeflection(Adrive, Fdrive, phi, self.Qm0, dt_dense)
# Set initial conditions
ss0 = self.pneuron.getSteadyStates(self.pneuron.Vm0)
y0 = np.concatenate(([0., 0., self.ng0, self.Qm0], ss0))
y1 = np.concatenate(([0., Z, self.ng0, self.Qm0], ss0))
# Initialize simulator and compute solution
is_dense_var = np.array([True] * 3 + [False] * (len(self.pneuron.states) + 1))
logger.debug('Computing hybrid solution')
simulator = HybridSimulator(
lambda t, y: self.fullDerivatives(t, y, Fdrive, Adrive, phi, fs),
lambda t, y: self.fullDerivatives(t, y, 0., 0., 0., fs),
lambda t, y, Cm: self.pneuron.derivatives(
t, y, Cm=self.spatialAverage(fs, Cm, self.Cm0)),
lambda yref: self.capacitance(yref[1]),
is_dense_var,
ivars_to_check=[1, 2])
t, y, stim = simulator(y1, dt_dense, dt_sparse, 1. / Fdrive, tstim, toffset, PRF, DC)
# Prepend initial conditions (prior to stimulation)
t, y, stim = simulator.prependSolution(t, y, stim, y0=y0)
# Store output in dataframe and return
data = pd.DataFrame({
't': t,
'stimstate': stim,
'Z': y[:, 1],
'ng': y[:, 2],
'Qm': y[:, 3]
})
data['Vm'] = data['Qm'].values / self.spatialAverage(
fs, self.v_capacitance(data['Z'].values), self.Cm0) * 1e3 # mV
for i in range(len(self.pneuron.states)):
data[self.pneuron.statesNames()[i]] = y[:, i + 4]
return data
def __simSonic(self, Fdrive, Adrive, tstim, toffset, PRF, DC, fs):
# Load appropriate 2D lookups
lkp2d = self.getLookup2D(Fdrive, fs)
# Interpolate 2D lookups at zero and US amplitude
logger.debug('Interpolating lookups at A = %.2f kPa and A = 0', Adrive * 1e-3)
lkps1d = {'ON': lkp2d.project('A', Adrive), 'OFF': lkp2d.project('A', 0.)}
# Set initial conditions
y0 = np.concatenate(([self.Qm0], self.pneuron.getSteadyStates(self.pneuron.Vm0)))
# Initialize simulator and compute solution
logger.debug('Computing effective solution')
simulator = PWSimulator(
lambda t, y: self.effDerivatives(t, y, lkps1d['ON']),
lambda t, y: self.effDerivatives(t, y, lkps1d['OFF']))
t, y, stim = simulator(y0, self.pneuron.chooseTimeStep(), tstim, toffset, PRF, DC)
# Prepend initial conditions (prior to stimulation)
t, y, stim = simulator.prependSolution(t, y, stim)
# Store output in dataframe and return
data = pd.DataFrame({
't': t,
'stimstate': stim,
'Qm': y[:, 0]
})
data['Vm'] = self.interpOnOffVariable('V', data['Qm'].values, stim, lkps1d)
for key in ['Z', 'ng']:
data[key] = np.full(t.size, np.nan)
for i in range(len(self.pneuron.states)):
data[self.pneuron.statesNames()[i]] = y[:, i + 1]
return data
@classmethod
def simQueue(cls, freqs, amps, durations, offsets, PRFs, DCs, fs, methods, outputdir=None):
''' Create a serialized 2D array of all parameter combinations for a series of individual
parameter sweeps, while avoiding repetition of CW protocols for a given PRF sweep.
:param freqs: list (or 1D-array) of US frequencies
:param amps: list (or 1D-array) of acoustic amplitudes
:param durations: list (or 1D-array) of stimulus durations
:param offsets: list (or 1D-array) of stimulus offsets (paired with durations array)
:param PRFs: list (or 1D-array) of pulse-repetition frequencies
:param DCs: list (or 1D-array) of duty cycle values
:param fs: sonophore membrane coverage fractions (-)
:params methods: integration methods
:return: list of parameters (list) for each simulation
'''
method_ids = list(range(len(methods)))
if ('full' in methods or 'hybrid' in methods) and outputdir is None:
logger.warning('Running cumbersome simulation(s) without file saving')
if amps is None:
amps = [np.nan]
DCs = np.array(DCs)
queue = []
if 1.0 in DCs:
queue += Batch.createQueue(
freqs, amps, durations, offsets, min(PRFs), 1.0, fs, method_ids)
if np.any(DCs != 1.0):
queue += Batch.createQueue(
freqs, amps, durations, offsets, PRFs, DCs[DCs != 1.0], fs, method_ids)
for item in queue:
if np.isnan(item[1]):
item[1] = None
item[-1] = methods[int(item[-1])]
return cls.checkOutputDir(queue, outputdir)
@Model.logNSpikes
@Model.checkTitrate('Adrive')
@Model.addMeta
def simulate(self, Fdrive, Adrive, tstim, toffset, PRF=100., DC=1., fs=1., method='sonic'):
''' Simulate the electro-mechanical model for a specific set of US stimulation parameters,
and return output data in a dataframe.
:param Fdrive: acoustic drive frequency (Hz)
:param Adrive: acoustic drive amplitude (Pa)
:param tstim: duration of US stimulation (s)
:param toffset: duration of the offset (s)
:param PRF: pulse repetition frequency (Hz)
:param DC: pulse duty cycle (-)
:param fs: sonophore membrane coverage fraction (-)
:param method: selected integration method
:return: 2-tuple with the output dataframe and computation time.
'''
logger.info(
'%s: simulation @ f = %sHz, A = %sPa, t = %ss (%ss offset)%s%s',
self, si_format(Fdrive, 0, space=' '), si_format(Adrive, 2, space=' '),
*si_format([tstim, toffset], 1, space=' '),
(', PRF = {}Hz, DC = {:.2f}%'.format(
si_format(PRF, 2, space=' '), DC * 1e2) if DC < 1.0 else ''),
', fs = {:.2f}%'.format(fs * 1e2) if fs < 1.0 else '')
# Check validity of stimulation parameters
BilayerSonophore.checkInputs(Fdrive, Adrive, 0.0, 0.0)
PointNeuron.checkInputs(Adrive, tstim, toffset, PRF, DC)
# Call appropriate simulation function and return
try:
simfunc = {
'full': self.__simFull,
'hybrid': self.__simHybrid,
'sonic': self.__simSonic
}[method]
except KeyError:
raise ValueError('Invalid integration method: "{}"'.format(method))
return simfunc(Fdrive, Adrive, tstim, toffset, PRF, DC, fs)
def meta(self, Fdrive, Adrive, tstim, toffset, PRF, DC, fs, method):
return {
'simkey': self.simkey,
'neuron': self.pneuron.name,
'a': self.a,
'd': self.d,
'Fdrive': Fdrive,
'Adrive': Adrive,
'tstim': tstim,
'toffset': toffset,
'PRF': PRF,
'DC': DC,
'fs': fs,
'method': method
}
@staticmethod
def getNSpikes(data):
return PointNeuron.getNSpikes(data)
@logCache(os.path.join(os.path.split(__file__)[0], 'astim_titrations.log'))
def titrate(self, Fdrive, tstim, toffset, PRF=100., DC=1., fs=1., method='sonic',
xfunc=None, Arange=None):
''' Use a binary search to determine the threshold amplitude needed to obtain
neural excitation for a given frequency, duration, PRF and duty cycle.
:param Fdrive: US frequency (Hz)
:param tstim: duration of US stimulation (s)
:param toffset: duration of the offset (s)
:param PRF: pulse repetition frequency (Hz)
:param DC: pulse duty cycle (-)
:param fs: sonophore membrane coverage fraction (-)
:param method: integration method
:param xfunc: function determining whether condition is reached from simulation output
:param Arange: search interval for Adrive, iteratively refined
:return: determined threshold amplitude (Pa)
'''
# Default output function
if xfunc is None:
xfunc = self.pneuron.titrationFunc
# Default amplitude interval
if Arange is None:
Arange = [0., self.getLookup().refs['A'].max()]
return binarySearch(
lambda x: xfunc(self.simulate(*x)[0]),
[Fdrive, tstim, toffset, PRF, DC, fs, method], 1, Arange, THRESHOLD_CONV_RANGE_ASTIM
)
def getQuasiSteadyStates(self, Fdrive, amps=None, charges=None, DCs=1.0, squeeze_output=False):
''' Compute the quasi-steady state values of the neuron's gating variables
for a combination of US amplitudes, charge densities and duty cycles,
at a specific US frequency.
:param Fdrive: US frequency (Hz)
:param amps: US amplitudes (Pa)
:param charges: membrane charge densities (C/m2)
:param DCs: duty cycle value(s)
:return: 4-tuple with reference values of US amplitude and charge density,
as well as interpolated Vmeff and QSS gating variables
'''
# Get DC-averaged lookups interpolated at the appropriate amplitudes and charges
lkp = self.getLookup().projectDCs(amps=amps, DCs=DCs).projectN({'a': self.a, 'f': Fdrive})
if charges is not None:
lkp = lkp.project('Q', charges)
# Specify dimensions with A and DC as the first two axes
A_axis = lkp.getAxisIndex('A')
lkp.move('A', 0)
lkp.move('DC', 1)
nA, nDC = lkp.dims()[:2]
# Compute QSS states using these lookups
QSS = {k: np.empty(lkp.dims()) for k in self.pneuron.statesNames()}
for iA in range(nA):
for iDC in range(nDC):
lkp1d = SmartDict({k: v[iA, iDC] for k, v in lkp.items()})
QSS_1D = {k: v(lkp1d) for k, v in self.pneuron.quasiSteadyStates().items()}
for k in QSS.keys():
QSS[k][iA, iDC] = QSS_1D[k]
QSS = SmartLookup(lkp.refs, QSS)
for item in [lkp, QSS]:
item.move('A', A_axis)
item.move('DC', -1)
# Compress outputs if needed
if squeeze_output:
QSS = QSS.squeeze()
lkp = lkp.squeeze()
return lkp, QSS
def iNetQSS(self, Qm, Fdrive, Adrive, DC):
''' Compute quasi-steady state net membrane current for a given combination
of US parameters and a given membrane charge density.
:param Qm: membrane charge density (C/m2)
:param Fdrive: US frequency (Hz)
:param Adrive: US amplitude (Pa)
:param DC: duty cycle (-)
:return: net membrane current (mA/m2)
'''
lkp, QSS = self.getQuasiSteadyStates(
Fdrive, amps=Adrive, charges=Qm, DCs=DC, squeeze_output=True)
return self.pneuron.iNet(lkp['V'], QSS) # mA/m2
def fixedPointsQSS(self, Fdrive, Adrive, DC, lkp, dQdt):
''' Compute QSS fixed points along the charge dimension for a given combination
of US parameters, and determine their stability.
:param Fdrive: US frequency (Hz)
:param Adrive: US amplitude (Pa)
:param DC: duty cycle (-)
:param lkp: lookup dictionary for effective variables along charge dimension
:param dQdt: charge derivative profile along charge dimension
:return: 2-tuple with values of stable and unstable fixed points
'''
pltvars = self.getPltVars()
logger.debug('A = {:.2f} kPa, DC = {:.0f}%'.format(Adrive * 1e-3, DC * 1e2))
# Extract fixed points from QSS charge variation profile
def dfunc(Qm):
return - self.iNetQSS(Qm, Fdrive, Adrive, DC)
fixed_points = getFixedPoints(
lkp.refs['Q'], dQdt, filter='both', der_func=dfunc).tolist()
dfunc = lambda x: np.array(self.effDerivatives(_, x, lkp))
classified_fixed_points = {'stable': [], 'unstable': [], 'saddle': []}
np.set_printoptions(precision=2)
# For each fixed point
for i, Qm in enumerate(fixed_points):
# Re-compute QSS at fixed point
*_, QSS = self.getQuasiSteadyStates(Fdrive, amps=Adrive, charges=Qm, DCs=DC,
squeeze_output=True)
# Approximate the system's Jacobian matrix at the fixed-point and compute its eigenvalues
x = np.array([Qm, *QSS.tables.values()])
print(f'x = {x}, dfunx(x) = {dfunc(x)}')
eps_machine = np.sqrt(np.finfo(float).eps)
J = jacobian(dfunc, x, rel_eps=eps_machine, method='forward')
# Jfunc = nd.Jacobian(dfunc, order=3)
# J = Jfunc(x)
# print('------------------ Jacobian ------------------')
# names = ['Q'] + self.pneuron.statesNames()
# for name, Jline in zip(names, J):
# print(f'd(d{name}dt) = {Jline}')
# Determine fixed point stability based on eigenvalues
eigvals, eigvecs = linalg.eig(J)
s = ['({0.real:.2e} + {0.imag:.2e}j)'.format(x) for x in eigvals]
print(f'eigenvalues = {s}')
is_real_eigvals = np.isreal(eigvals)
print(is_real_eigvals)
is_neg_eigvals = eigvals.real < 0
if np.all(is_neg_eigvals):
key = 'stable'
elif np.any(is_neg_eigvals):
key = 'saddle'
else:
key = 'unstable'
classified_fixed_points[key].append(Qm)
logger.debug(f'{key} fixed point @ Q = {(Qm * 1e5):.1f} nC/cm2')
return classified_fixed_points
def isStableQSS(self, Fdrive, Adrive, DC):
lookups, QSS = self.getQuasiSteadyStates(
Fdrive, amps=Adrive, DCs=DC, squeeze_output=True)
dQdt = -self.pneuron.iNet(lookups['V'], QSS.tables) # mA/m2
classified_fixed_points = self.fixedPointsQSS(Fdrive, Adrive, DC, lookups, dQdt)
return len(classified_fixed_points['stable']) > 0
def titrateQSS(self, Fdrive, DC=1., Arange=None):
# Default amplitude interval
if Arange is None:
Arange = [0., self.getLookup().refs['A'].max()]
# Titration function
def xfunc(x):
if self.pneuron.name == 'STN':
return self.isStableQSS(*x)
else:
return not self.isStableQSS(*x)
return binarySearch(
xfunc,
[Fdrive, DC], 1, Arange, THRESHOLD_CONV_RANGE_ASTIM)

Event Timeline